C11H14NO6P — CID 46184886
2-amino-3-(3-ethenyl-4-phosphonooxyphenyl)propanoic acid (PubChem CID 46184886) has the molecular formula C11H14NO6P and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-amino-3-(3-ethenyl-4-phosphonooxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(3-ethenyl-4-phosphonooxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 46184886 |
| Molecular Formula | C11H14NO6P |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-amino-3-(3-ethenyl-4-phosphonooxyphenyl)propanoic acid |
| SMILES | C=Cc1cc(CC(N)C(=O)O)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C11H14NO6P/c1-2-8-5-7(6-9(12)11(13)14)3-4-10(8)18-19(15,16)17/h2-5,9H,1,6,12H2,(H,13,14)(H2,15,16,17) |
| InChIKey | YYHAUPZOYIFTFI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|