C11H11NO5 — CID 88907997
2-amino-3-(4-formyl-3-formyloxyphenyl)propanoic acid (PubChem CID 88907997) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 2-amino-3-(4-formyl-3-formyloxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(4-formyl-3-formyloxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 88907997 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-amino-3-(4-formyl-3-formyloxyphenyl)propanoic acid |
| SMILES | NC(Cc1ccc(C=O)c(OC=O)c1)C(=O)O |
| InChI | InChI=1S/C11H11NO5/c12-9(11(15)16)3-7-1-2-8(5-13)10(4-7)17-6-14/h1-2,4-6,9H,3,12H2,(H,15,16) |
| InChIKey | IKUJRTJTDLBIHX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|