C23H35NO6 — CID 77437238
2-amino-3-[3,4-bis(4,4-dimethylpentanoyloxy)phenyl]propanoic acid (PubChem CID 77437238) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-amino-3-[3,4-bis(4,4-dimethylpentanoyloxy)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3,4-bis(4,4-dimethylpentanoyloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 77437238 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2-amino-3-[3,4-bis(4,4-dimethylpentanoyloxy)phenyl]propanoic acid |
| SMILES | CC(C)(C)CCC(=O)Oc1ccc(CC(N)C(=O)O)cc1OC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C23H35NO6/c1-22(2,3)11-9-19(25)29-17-8-7-15(13-16(24)21(27)28)14-18(17)30-20(26)10-12-23(4,5)6/h7-8,14,16H,9-13,24H2,1-6H3,(H,27,28) |
| InChIKey | FBRAIAOUSCGBOR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|