C12H15NO4 — CID 131699147
[4-[(2S)-2-amino-3-hydroxypropyl]-2-formylphenyl] acetate (PubChem CID 131699147) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-hydroxypropyl]-2-formylphenyl] acetate.
| Compound Name | [4-[(2S)-2-amino-3-hydroxypropyl]-2-formylphenyl] acetate |
|---|---|
| PubChem CID | 131699147 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [4-[(2S)-2-amino-3-hydroxypropyl]-2-formylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C[C@H](N)CO)cc1C=O |
| InChI | InChI=1S/C12H15NO4/c1-8(16)17-12-3-2-9(4-10(12)6-14)5-11(13)7-15/h2-4,6,11,15H,5,7,13H2,1H3/t11-/m0/s1 |
| InChIKey | PIGFUAFOFXHNBH-NSHDSACASA-N |
| XLogP | 0.29 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|