C19H26N2O7 — CID 57290886
[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl] (2S)-2-amino-4-methylpentanoate (PubChem CID 57290886) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl] (2S)-2-amino-4-methylpentanoate.
| Compound Name | [(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl] (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 57290886 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl] (2S)-2-amino-4-methylpentanoate |
| SMILES | CC(=O)Oc1ccc(C[C@H](N)C(=O)OC(=O)[C@@H](N)CC(C)C)cc1OC(C)=O |
| InChI | InChI=1S/C19H26N2O7/c1-10(2)7-14(20)18(24)28-19(25)15(21)8-13-5-6-16(26-11(3)22)17(9-13)27-12(4)23/h5-6,9-10,14-15H,7-8,20-21H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | PHMXUNRUILEIDG-GJZGRUSLSA-N |
| XLogP | 0.85 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|