C21H30N2O7 — CID 22788102
ethyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(3,4-diacetyloxyphenyl)propanoate (PubChem CID 22788102) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(3,4-diacetyloxyphenyl)propanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(3,4-diacetyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 22788102 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(3,4-diacetyloxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OC(C)=O)c(OC(C)=O)c1)NC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C21H30N2O7/c1-6-28-21(27)17(23-20(26)16(22)9-12(2)3)10-15-7-8-18(29-13(4)24)19(11-15)30-14(5)25/h7-8,11-12,16-17H,6,9-10,22H2,1-5H3,(H,23,26)/t16-,17-/m0/s1 |
| InChIKey | JENKJALOCISQIH-IRXDYDNUSA-N |
| XLogP | 1.50 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|