C18H24N2O7 — CID 24738427
methyl (2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-(3,4-diacetyloxyphenyl)propanoate (PubChem CID 24738427) has the molecular formula C18H24N2O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl (2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-(3,4-diacetyloxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-(3,4-diacetyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 24738427 |
| Molecular Formula | C18H24N2O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | methyl (2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-(3,4-diacetyloxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OC(C)=O)c(OC(C)=O)c1)NC(=O)C(C)(C)N |
| InChI | InChI=1S/C18H24N2O7/c1-10(21)26-14-7-6-12(9-15(14)27-11(2)22)8-13(16(23)25-5)20-17(24)18(3,4)19/h6-7,9,13H,8,19H2,1-5H3,(H,20,24)/t13-/m0/s1 |
| InChIKey | WBWPMSUWZHHWIA-ZDUSSCGKSA-N |
| XLogP | 0.47 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|