C25H37NO8 — CID 58139666
[4-[3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-pentanoyloxyphenyl] pentanoate (PubChem CID 58139666) has the molecular formula C25H37NO8 and a molecular weight of 479.57 g/mol. Its IUPAC name is [4-[3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-pentanoyloxyphenyl] pentanoate.
| Compound Name | [4-[3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-pentanoyloxyphenyl] pentanoate |
|---|---|
| PubChem CID | 58139666 |
| Molecular Formula | C25H37NO8 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | [4-[3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-pentanoyloxyphenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(CC(NC(=O)OC(C)(C)C)C(=O)OC)cc1OC(=O)CCCC |
| InChI | InChI=1S/C25H37NO8/c1-7-9-11-21(27)32-19-14-13-17(16-20(19)33-22(28)12-10-8-2)15-18(23(29)31-6)26-24(30)34-25(3,4)5/h13-14,16,18H,7-12,15H2,1-6H3,(H,26,30) |
| InChIKey | ZIWANYINTKCKGQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|