C20H28N2O9 — CID 46935245
[4-[(2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-ethoxycarbonyloxyphenyl] ethyl carbonate (PubChem CID 46935245) has the molecular formula C20H28N2O9 and a molecular weight of 440.45 g/mol. Its IUPAC name is [4-[(2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-ethoxycarbonyloxyphenyl] ethyl carbonate.
| Compound Name | [4-[(2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-ethoxycarbonyloxyphenyl] ethyl carbonate |
|---|---|
| PubChem CID | 46935245 |
| Molecular Formula | C20H28N2O9 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [4-[(2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-ethoxycarbonyloxyphenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(N)=O)cc1OC(=O)OCC |
| InChI | InChI=1S/C20H28N2O9/c1-6-27-18(25)29-14-9-8-12(11-15(14)30-19(26)28-7-2)10-13(16(21)23)22-17(24)31-20(3,4)5/h8-9,11,13H,6-7,10H2,1-5H3,(H2,21,23)(H,22,24)/t13-/m0/s1 |
| InChIKey | AUPPTDBWADSBIK-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|