C21H29ClN2O7 — CID 24738432
[1-[[(2S)-3-(3,4-diacetyloxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]cyclohexyl]azanium chloride (PubChem CID 24738432) has the molecular formula C21H29ClN2O7 and a molecular weight of 456.92 g/mol. Its IUPAC name is [1-[[(2S)-3-(3,4-diacetyloxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]cyclohexyl]azanium chloride.
| Compound Name | [1-[[(2S)-3-(3,4-diacetyloxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]cyclohexyl]azanium chloride |
|---|---|
| PubChem CID | 24738432 |
| Molecular Formula | C21H29ClN2O7 |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [1-[[(2S)-3-(3,4-diacetyloxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]cyclohexyl]azanium chloride |
| SMILES | COC(=O)[C@H](Cc1ccc(OC(C)=O)c(OC(C)=O)c1)NC(=O)C1([NH3+])CCCCC1.[Cl-] |
| InChI | InChI=1S/C21H28N2O7.ClH/c1-13(24)29-17-8-7-15(12-18(17)30-14(2)25)11-16(19(26)28-3)23-20(27)21(22)9-5-4-6-10-21;/h7-8,12,16H,4-6,9-11,22H2,1-3H3,(H,23,27);1H/t16-;/m0./s1 |
| InChIKey | KHEANQJWBHODPA-NTISSMGPSA-N |
| XLogP | -2.31 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|