C15H19NO6 — CID 11565804
methyl (2R)-2-acetamido-3-(3-acetyloxy-4-methoxyphenyl)propanoate (PubChem CID 11565804) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-(3-acetyloxy-4-methoxyphenyl)propanoate.
| Compound Name | methyl (2R)-2-acetamido-3-(3-acetyloxy-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 11565804 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | methyl (2R)-2-acetamido-3-(3-acetyloxy-4-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(OC)c(OC(C)=O)c1)NC(C)=O |
| InChI | InChI=1S/C15H19NO6/c1-9(17)16-12(15(19)21-4)7-11-5-6-13(20-3)14(8-11)22-10(2)18/h5-6,8,12H,7H2,1-4H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | PFEOFBWQFLUTLK-GFCCVEGCSA-N |
| XLogP | 0.84 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|