C21H21NO7 — CID 11133103
methyl 2-acetamido-3-(8,9-dimethoxy-6-oxobenzo[c]chromen-2-yl)propanoate (PubChem CID 11133103) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is methyl 2-acetamido-3-(8,9-dimethoxy-6-oxobenzo[c]chromen-2-yl)propanoate.
| Compound Name | methyl 2-acetamido-3-(8,9-dimethoxy-6-oxobenzo[c]chromen-2-yl)propanoate |
|---|---|
| PubChem CID | 11133103 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | methyl 2-acetamido-3-(8,9-dimethoxy-6-oxobenzo[c]chromen-2-yl)propanoate |
| SMILES | COC(=O)C(Cc1ccc2oc(=O)c3cc(OC)c(OC)cc3c2c1)NC(C)=O |
| InChI | InChI=1S/C21H21NO7/c1-11(23)22-16(21(25)28-4)8-12-5-6-17-14(7-12)13-9-18(26-2)19(27-3)10-15(13)20(24)29-17/h5-7,9-10,16H,8H2,1-4H3,(H,22,23) |
| InChIKey | BSVYQBUTJDBHFZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|