C26H32N2O7 — CID 22788095
benzyl (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-(3,4-diacetyloxyphenyl)propanoate (PubChem CID 22788095) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-(3,4-diacetyloxyphenyl)propanoate.
| Compound Name | benzyl (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-(3,4-diacetyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 22788095 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | benzyl (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-(3,4-diacetyloxyphenyl)propanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](Cc1ccc(OC(C)=O)c(OC(C)=O)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H32N2O7/c1-5-16(2)24(27)25(31)28-21(26(32)33-15-19-9-7-6-8-10-19)13-20-11-12-22(34-17(3)29)23(14-20)35-18(4)30/h6-12,14,16,21,24H,5,13,15,27H2,1-4H3,(H,28,31)/t16-,21-,24-/m0/s1 |
| InChIKey | UGGBLJBQMAETJJ-SWDVRCMSSA-N |
| XLogP | 2.68 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|