C32H29NO8 — CID 102062435
benzyl (2S)-2-amino-3-[3,4-bis(phenylmethoxycarbonyloxy)phenyl]propanoate (PubChem CID 102062435) has the molecular formula C32H29NO8 and a molecular weight of 555.58 g/mol. Its IUPAC name is benzyl (2S)-2-amino-3-[3,4-bis(phenylmethoxycarbonyloxy)phenyl]propanoate.
| Compound Name | benzyl (2S)-2-amino-3-[3,4-bis(phenylmethoxycarbonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 102062435 |
| Molecular Formula | C32H29NO8 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | benzyl (2S)-2-amino-3-[3,4-bis(phenylmethoxycarbonyloxy)phenyl]propanoate |
| SMILES | N[C@@H](Cc1ccc(OC(=O)OCc2ccccc2)c(OC(=O)OCc2ccccc2)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H29NO8/c33-27(30(34)37-20-23-10-4-1-5-11-23)18-26-16-17-28(40-31(35)38-21-24-12-6-2-7-13-24)29(19-26)41-32(36)39-22-25-14-8-3-9-15-25/h1-17,19,27H,18,20-22,33H2/t27-/m0/s1 |
| InChIKey | AOHPXPMZKVAWIG-MHZLTWQESA-N |
| XLogP | 5.73 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|