C19H23NO3 — CID 144719358
ethyl 2-amino-3-(4-methyl-3-phenylmethoxyphenyl)propanoate (PubChem CID 144719358) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl 2-amino-3-(4-methyl-3-phenylmethoxyphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(4-methyl-3-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 144719358 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | ethyl 2-amino-3-(4-methyl-3-phenylmethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(C)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO3/c1-3-22-19(21)17(20)11-16-10-9-14(2)18(12-16)23-13-15-7-5-4-6-8-15/h4-10,12,17H,3,11,13,20H2,1-2H3 |
| InChIKey | KDRNSPYZJZBSAM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |