C24H25NO3 — CID 154815416
ethyl (2R)-2-amino-3-[3-(3-phenylmethoxyphenyl)phenyl]propanoate (PubChem CID 154815416) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl (2R)-2-amino-3-[3-(3-phenylmethoxyphenyl)phenyl]propanoate.
| Compound Name | ethyl (2R)-2-amino-3-[3-(3-phenylmethoxyphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 154815416 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | ethyl (2R)-2-amino-3-[3-(3-phenylmethoxyphenyl)phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](N)Cc1cccc(-c2cccc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H25NO3/c1-2-27-24(26)23(25)15-19-10-6-11-20(14-19)21-12-7-13-22(16-21)28-17-18-8-4-3-5-9-18/h3-14,16,23H,2,15,17,25H2,1H3/t23-/m1/s1 |
| InChIKey | QRNOACBEYIFBKO-HSZRJFAPSA-N |
| XLogP | 4.37 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |