C19H23NO2 — CID 170885045
ethyl 2-amino-3-[3-(3,5-dimethylphenyl)phenyl]propanoate (PubChem CID 170885045) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is ethyl 2-amino-3-[3-(3,5-dimethylphenyl)phenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[3-(3,5-dimethylphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 170885045 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethyl 2-amino-3-[3-(3,5-dimethylphenyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1cccc(-c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C19H23NO2/c1-4-22-19(21)18(20)12-15-6-5-7-16(11-15)17-9-13(2)8-14(3)10-17/h5-11,18H,4,12,20H2,1-3H3 |
| InChIKey | AYUGNHJLFLHTNB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |