C12H12F3NO4S — CID 46185661
2-amino-3-[3-ethenyl-4-(trifluoromethylsulfonyl)phenyl]propanoic acid (PubChem CID 46185661) has the molecular formula C12H12F3NO4S and a molecular weight of 323.29 g/mol. Its IUPAC name is 2-amino-3-[3-ethenyl-4-(trifluoromethylsulfonyl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-ethenyl-4-(trifluoromethylsulfonyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 46185661 |
| Molecular Formula | C12H12F3NO4S |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-amino-3-[3-ethenyl-4-(trifluoromethylsulfonyl)phenyl]propanoic acid |
| SMILES | C=Cc1cc(CC(N)C(=O)O)ccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4S/c1-2-8-5-7(6-9(16)11(17)18)3-4-10(8)21(19,20)12(13,14)15/h2-5,9H,1,6,16H2,(H,17,18) |
| InChIKey | KZZYLZZRLJMWTO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |