C11H15N2O5P — CID 46185160
2-amino-3-[3-ethenyl-4-(phosphonoamino)phenyl]propanoic acid (PubChem CID 46185160) has the molecular formula C11H15N2O5P and a molecular weight of 286.22 g/mol. Its IUPAC name is 2-amino-3-[3-ethenyl-4-(phosphonoamino)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-ethenyl-4-(phosphonoamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 46185160 |
| Molecular Formula | C11H15N2O5P |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-amino-3-[3-ethenyl-4-(phosphonoamino)phenyl]propanoic acid |
| SMILES | C=Cc1cc(CC(N)C(=O)O)ccc1NP(=O)(O)O |
| InChI | InChI=1S/C11H15N2O5P/c1-2-8-5-7(6-9(12)11(14)15)3-4-10(8)13-19(16,17)18/h2-5,9H,1,6,12H2,(H,14,15)(H3,13,16,17,18) |
| InChIKey | RDBUGOHSFGRDNY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|