C11H16NO7P — CID 121288700
[5-[(2S)-2-amino-3-oxobutyl]-2-hydroxyphenoxy]methyl dihydrogen phosphate (PubChem CID 121288700) has the molecular formula C11H16NO7P and a molecular weight of 305.22 g/mol. Its IUPAC name is [5-[(2S)-2-amino-3-oxobutyl]-2-hydroxyphenoxy]methyl dihydrogen phosphate.
| Compound Name | [5-[(2S)-2-amino-3-oxobutyl]-2-hydroxyphenoxy]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 121288700 |
| Molecular Formula | C11H16NO7P |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | [5-[(2S)-2-amino-3-oxobutyl]-2-hydroxyphenoxy]methyl dihydrogen phosphate |
| SMILES | CC(=O)[C@@H](N)Cc1ccc(O)c(OCOP(=O)(O)O)c1 |
| InChI | InChI=1S/C11H16NO7P/c1-7(13)9(12)4-8-2-3-10(14)11(5-8)18-6-19-20(15,16)17/h2-3,5,9,14H,4,6,12H2,1H3,(H2,15,16,17)/t9-/m0/s1 |
| InChIKey | VKHPUHKUQCPMKY-VIFPVBQESA-N |
| XLogP | 0.30 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|