C16H20N2O7S — CID 126677647
(3S)-3-acetamido-4-[5-[(2S)-2-amino-3-oxobutyl]-2-hydroxyphenyl]peroxy-4-oxobutanethioic S-acid (PubChem CID 126677647) has the molecular formula C16H20N2O7S and a molecular weight of 384.41 g/mol. Its IUPAC name is (3S)-3-acetamido-4-[5-[(2S)-2-amino-3-oxobutyl]-2-hydroxyphenyl]peroxy-4-oxobutanethioic S-acid.
| Compound Name | (3S)-3-acetamido-4-[5-[(2S)-2-amino-3-oxobutyl]-2-hydroxyphenyl]peroxy-4-oxobutanethioic S-acid |
|---|---|
| PubChem CID | 126677647 |
| Molecular Formula | C16H20N2O7S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (3S)-3-acetamido-4-[5-[(2S)-2-amino-3-oxobutyl]-2-hydroxyphenyl]peroxy-4-oxobutanethioic S-acid |
| SMILES | CC(=O)N[C@@H](CC(=O)S)C(=O)OOc1cc(C[C@H](N)C(C)=O)ccc1O |
| InChI | InChI=1S/C16H20N2O7S/c1-8(19)11(17)5-10-3-4-13(21)14(6-10)24-25-16(23)12(7-15(22)26)18-9(2)20/h3-4,6,11-12,21H,5,7,17H2,1-2H3,(H,18,20)(H,22,26)/t11-,12-/m0/s1 |
| InChIKey | ACOJCBCASNQDSQ-RYUDHWBXSA-N |
| XLogP | 0.04 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|