C12H15NO7S — CID 15859153
(2S)-2-acetamido-3-(4-hydroxy-3-methylsulfonyloxyphenyl)propanoic acid (PubChem CID 15859153) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is (2S)-2-acetamido-3-(4-hydroxy-3-methylsulfonyloxyphenyl)propanoic acid.
| Compound Name | (2S)-2-acetamido-3-(4-hydroxy-3-methylsulfonyloxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 15859153 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2S)-2-acetamido-3-(4-hydroxy-3-methylsulfonyloxyphenyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)c(OS(C)(=O)=O)c1)C(=O)O |
| InChI | InChI=1S/C12H15NO7S/c1-7(14)13-9(12(16)17)5-8-3-4-10(15)11(6-8)20-21(2,18)19/h3-4,6,9,15H,5H2,1-2H3,(H,13,14)(H,16,17)/t9-/m0/s1 |
| InChIKey | RUNZXXKZEUMENP-VIFPVBQESA-N |
| XLogP | -0.14 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|