C16H21N2O8- — CID 131725923
(2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-hydrazinyl-2-methylpropanoate (PubChem CID 131725923) has the molecular formula C16H21N2O8- and a molecular weight of 369.35 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-hydrazinyl-2-methylpropanoate.
| Compound Name | (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-hydrazinyl-2-methylpropanoate |
|---|---|
| PubChem CID | 131725923 |
| Molecular Formula | C16H21N2O8- |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-hydrazinyl-2-methylpropanoate |
| SMILES | CCOC(=O)Oc1ccc(C[C@](C)(NN)C(=O)[O-])cc1OC(=O)OCC |
| InChI | InChI=1S/C16H22N2O8/c1-4-23-14(21)25-11-7-6-10(9-16(3,18-17)13(19)20)8-12(11)26-15(22)24-5-2/h6-8,18H,4-5,9,17H2,1-3H3,(H,19,20)/p-1/t16-/m0/s1 |
| InChIKey | OQISSCSIMSUDCO-INIZCTEOSA-M |
| XLogP | 0.27 |
| TPSA | 149.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|