C59H56N2O12P2 — CID 131737187
benzhydryl (2S)-3-[3,4-bis[bis(phenylmethoxy)phosphoryloxy]phenyl]-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate (PubChem CID 131737187) has the molecular formula C59H56N2O12P2 and a molecular weight of 1047.05 g/mol. Its IUPAC name is benzhydryl (2S)-3-[3,4-bis[bis(phenylmethoxy)phosphoryloxy]phenyl]-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate.
| Compound Name | benzhydryl (2S)-3-[3,4-bis[bis(phenylmethoxy)phosphoryloxy]phenyl]-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate |
|---|---|
| PubChem CID | 131737187 |
| Molecular Formula | C59H56N2O12P2 |
| Molecular Weight | 1047.05 g/mol |
| Exact Mass | 1046.33 |
| IUPAC Name | benzhydryl (2S)-3-[3,4-bis[bis(phenylmethoxy)phosphoryloxy]phenyl]-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate |
| SMILES | C[C@@](Cc1ccc(OP(=O)(OCc2ccccc2)OCc2ccccc2)c(OP(=O)(OCc2ccccc2)OCc2ccccc2)c1)(NNC(=O)OCc1ccccc1)C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C59H56N2O12P2/c1-59(61-60-58(63)66-41-46-23-9-2-10-24-46,57(62)71-56(52-33-19-7-20-34-52)53-35-21-8-22-36-53)40-51-37-38-54(72-74(64,67-42-47-25-11-3-12-26-47)68-43-48-27-13-4-14-28-48)55(39-51)73-75(65,69-44-49-29-15-5-16-30-49)70-45-50-31-17-6-18-32-50/h2-39,56,61H,40-45H2,1H3,(H,60,63)/t59-/m0/s1 |
| InChIKey | HWLZTBTZELSULF-MNPYLUJASA-N |
| XLogP | 13.59 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.05 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|