C32H29NO6 — CID 70494708
(2-benzhydryloxy-2-oxo-1-phenylethyl) (2S)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 70494708) has the molecular formula C32H29NO6 and a molecular weight of 523.59 g/mol. Its IUPAC name is (2-benzhydryloxy-2-oxo-1-phenylethyl) (2S)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (2-benzhydryloxy-2-oxo-1-phenylethyl) (2S)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 70494708 |
| Molecular Formula | C32H29NO6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | (2-benzhydryloxy-2-oxo-1-phenylethyl) (2S)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C(=O)OC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29NO6/c1-23(33-32(36)37-22-24-14-6-2-7-15-24)30(34)39-29(27-20-12-5-13-21-27)31(35)38-28(25-16-8-3-9-17-25)26-18-10-4-11-19-26/h2-21,23,28-29H,22H2,1H3,(H,33,36)/t23-,29?/m0/s1 |
| InChIKey | JTPWPXLOUSBCFP-QASNXKAYSA-N |
| XLogP | 5.92 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|