C19H19NO5S — CID 102092850
(2R)-2-phenyl-2-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]sulfanylacetic acid (PubChem CID 102092850) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]sulfanylacetic acid.
| Compound Name | (2R)-2-phenyl-2-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 102092850 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (2R)-2-phenyl-2-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]sulfanylacetic acid |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)S[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO5S/c1-13(20-19(24)25-12-14-8-4-2-5-9-14)18(23)26-16(17(21)22)15-10-6-3-7-11-15/h2-11,13,16H,12H2,1H3,(H,20,24)(H,21,22)/t13-,16+/m0/s1 |
| InChIKey | CUSAVZBMUJXUGZ-XJKSGUPXSA-N |
| XLogP | 3.39 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|