C22H28N2O7 — CID 131737186
(2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoic acid;oxolane (PubChem CID 131737186) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoic acid;oxolane.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoic acid;oxolane |
|---|---|
| PubChem CID | 131737186 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoic acid;oxolane |
| SMILES | C1CCOC1.C[C@@](Cc1ccc(O)c(O)c1)(NNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O6.C4H8O/c1-18(16(23)24,10-13-7-8-14(21)15(22)9-13)20-19-17(25)26-11-12-5-3-2-4-6-12;1-2-4-5-3-1/h2-9,20-22H,10-11H2,1H3,(H,19,25)(H,23,24);1-4H2/t18-;/m0./s1 |
| InChIKey | BLPLSWFHTBFWCU-FERBBOLQSA-N |
| XLogP | 2.71 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|