C25H34N2O6 — CID 71665204
pentan-3-yl (2S)-3-(3,4-dimethoxyphenyl)-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate (PubChem CID 71665204) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is pentan-3-yl (2S)-3-(3,4-dimethoxyphenyl)-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate.
| Compound Name | pentan-3-yl (2S)-3-(3,4-dimethoxyphenyl)-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate |
|---|---|
| PubChem CID | 71665204 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | pentan-3-yl (2S)-3-(3,4-dimethoxyphenyl)-2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate |
| SMILES | CCC(CC)OC(=O)[C@](C)(Cc1ccc(OC)c(OC)c1)NNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H34N2O6/c1-6-20(7-2)33-23(28)25(3,16-19-13-14-21(30-4)22(15-19)31-5)27-26-24(29)32-17-18-11-9-8-10-12-18/h8-15,20,27H,6-7,16-17H2,1-5H3,(H,26,29)/t25-/m0/s1 |
| InChIKey | GJKACVYKIISCJT-VWLOTQADSA-N |
| XLogP | 4.17 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|