C36H39N3O7 — CID 165117038
benzyl (2S)-3-(4-hydroxy-3-phenylmethoxyphenyl)-2-methyl-2-[2-[4-(phenylmethoxycarbonylamino)butanoyl]hydrazinyl]propanoate (PubChem CID 165117038) has the molecular formula C36H39N3O7 and a molecular weight of 625.72 g/mol. Its IUPAC name is benzyl (2S)-3-(4-hydroxy-3-phenylmethoxyphenyl)-2-methyl-2-[2-[4-(phenylmethoxycarbonylamino)butanoyl]hydrazinyl]propanoate.
| Compound Name | benzyl (2S)-3-(4-hydroxy-3-phenylmethoxyphenyl)-2-methyl-2-[2-[4-(phenylmethoxycarbonylamino)butanoyl]hydrazinyl]propanoate |
|---|---|
| PubChem CID | 165117038 |
| Molecular Formula | C36H39N3O7 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | benzyl (2S)-3-(4-hydroxy-3-phenylmethoxyphenyl)-2-methyl-2-[2-[4-(phenylmethoxycarbonylamino)butanoyl]hydrazinyl]propanoate |
| SMILES | C[C@@](Cc1ccc(O)c(OCc2ccccc2)c1)(NNC(=O)CCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H39N3O7/c1-36(34(42)45-25-28-14-7-3-8-15-28,23-30-19-20-31(40)32(22-30)44-24-27-12-5-2-6-13-27)39-38-33(41)18-11-21-37-35(43)46-26-29-16-9-4-10-17-29/h2-10,12-17,19-20,22,39-40H,11,18,21,23-26H2,1H3,(H,37,43)(H,38,41)/t36-/m0/s1 |
| InChIKey | NUDKPGJLDGXFRD-BHVANESWSA-N |
| XLogP | 5.34 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|