C40H41N2O11PS — CID 166028473
2-[[(2S)-3-[4-bis(phenylmethoxy)phosphoryloxy-3-phenylmethoxyphenyl]-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethanesulfonic acid (PubChem CID 166028473) has the molecular formula C40H41N2O11PS and a molecular weight of 788.81 g/mol. Its IUPAC name is 2-[[(2S)-3-[4-bis(phenylmethoxy)phosphoryloxy-3-phenylmethoxyphenyl]-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(2S)-3-[4-bis(phenylmethoxy)phosphoryloxy-3-phenylmethoxyphenyl]-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 166028473 |
| Molecular Formula | C40H41N2O11PS |
| Molecular Weight | 788.81 g/mol |
| Exact Mass | 788.22 |
| IUPAC Name | 2-[[(2S)-3-[4-bis(phenylmethoxy)phosphoryloxy-3-phenylmethoxyphenyl]-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethanesulfonic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(OP(=O)(OCc2ccccc2)OCc2ccccc2)c(OCc2ccccc2)c1)C(=O)NCCS(=O)(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C40H41N2O11PS/c43-39(41-23-24-55(46,47)48)36(42-40(44)50-28-32-15-7-2-8-16-32)25-35-21-22-37(38(26-35)49-27-31-13-5-1-6-14-31)53-54(45,51-29-33-17-9-3-10-18-33)52-30-34-19-11-4-12-20-34/h1-22,26,36H,23-25,27-30H2,(H,41,43)(H,42,44)(H,46,47,48)/t36-/m0/s1 |
| InChIKey | BKSBMPHSNMGDFN-BHVANESWSA-N |
| XLogP | 7.03 |
| TPSA | 175.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|