C55H53N2O11P — CID 168763796
benzyl (2S)-3-[3,4-bis(phenylmethoxy)phenyl]-2-[[(2S)-3-bis(phenylmethoxy)phosphoryloxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate (PubChem CID 168763796) has the molecular formula C55H53N2O11P and a molecular weight of 949.01 g/mol. Its IUPAC name is benzyl (2S)-3-[3,4-bis(phenylmethoxy)phenyl]-2-[[(2S)-3-bis(phenylmethoxy)phosphoryloxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate.
| Compound Name | benzyl (2S)-3-[3,4-bis(phenylmethoxy)phenyl]-2-[[(2S)-3-bis(phenylmethoxy)phosphoryloxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 168763796 |
| Molecular Formula | C55H53N2O11P |
| Molecular Weight | 949.01 g/mol |
| Exact Mass | 948.34 |
| IUPAC Name | benzyl (2S)-3-[3,4-bis(phenylmethoxy)phenyl]-2-[[(2S)-3-bis(phenylmethoxy)phosphoryloxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
| SMILES | O=C(N[C@@H](COP(=O)(OCc1ccccc1)OCc1ccccc1)C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C55H53N2O11P/c58-53(50(57-55(60)65-38-45-25-13-4-14-26-45)41-68-69(61,66-39-46-27-15-5-16-28-46)67-40-47-29-17-6-18-30-47)56-49(54(59)64-37-44-23-11-3-12-24-44)33-48-31-32-51(62-35-42-19-7-1-8-20-42)52(34-48)63-36-43-21-9-2-10-22-43/h1-32,34,49-50H,33,35-41H2,(H,56,58)(H,57,60)/t49-,50-/m0/s1 |
| InChIKey | LGFQMUJLWPOEJW-WLTNIFSVSA-N |
| XLogP | 10.47 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.01 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|