C26H27N3O4 — CID 55942547
benzyl N-[(2S)-1-[2-(4-ethylbenzoyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 55942547) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-(4-ethylbenzoyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-(4-ethylbenzoyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 55942547 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | benzyl N-[(2S)-1-[2-(4-ethylbenzoyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCc1ccc(C(=O)NNC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-2-19-13-15-22(16-14-19)24(30)28-29-25(31)23(17-20-9-5-3-6-10-20)27-26(32)33-18-21-11-7-4-8-12-21/h3-16,23H,2,17-18H2,1H3,(H,27,32)(H,28,30)(H,29,31)/t23-/m0/s1 |
| InChIKey | XKCDWKQAALSGRJ-QHCPKHFHSA-N |
| XLogP | 3.55 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|