C22H21N3O5 — CID 9366703
benzyl N-[(2S)-1-[2-(furan-2-carbonyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 9366703) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-(furan-2-carbonyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-(furan-2-carbonyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 9366703 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | benzyl N-[(2S)-1-[2-(furan-2-carbonyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)NNC(=O)c1ccco1)OCc1ccccc1 |
| InChI | InChI=1S/C22H21N3O5/c26-20(24-25-21(27)19-12-7-13-29-19)18(14-16-8-3-1-4-9-16)23-22(28)30-15-17-10-5-2-6-11-17/h1-13,18H,14-15H2,(H,23,28)(H,24,26)(H,25,27)/t18-/m0/s1 |
| InChIKey | VTIFVVVUPZLLRS-SFHVURJKSA-N |
| XLogP | 2.58 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|