C10H15ClN2O4 — CID 141406892
methyl 2,2-diamino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride (PubChem CID 141406892) has the molecular formula C10H15ClN2O4 and a molecular weight of 262.69 g/mol. Its IUPAC name is methyl 2,2-diamino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl 2,2-diamino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 141406892 |
| Molecular Formula | C10H15ClN2O4 |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | methyl 2,2-diamino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C(N)(N)Cc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C10H14N2O4.ClH/c1-16-9(15)10(11,12)5-6-2-3-7(13)8(14)4-6;/h2-4,13-14H,5,11-12H2,1H3;1H |
| InChIKey | AVQDSSRBZNMDCM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|