C20H23NO6 — CID 67213974
[(4S)-4-amino-4-[(3,4-dihydroxyphenyl)methyl]-5-methoxy-5-oxopentyl] benzoate (PubChem CID 67213974) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is [(4S)-4-amino-4-[(3,4-dihydroxyphenyl)methyl]-5-methoxy-5-oxopentyl] benzoate.
| Compound Name | [(4S)-4-amino-4-[(3,4-dihydroxyphenyl)methyl]-5-methoxy-5-oxopentyl] benzoate |
|---|---|
| PubChem CID | 67213974 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [(4S)-4-amino-4-[(3,4-dihydroxyphenyl)methyl]-5-methoxy-5-oxopentyl] benzoate |
| SMILES | COC(=O)[C@](N)(CCCOC(=O)c1ccccc1)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H23NO6/c1-26-19(25)20(21,13-14-8-9-16(22)17(23)12-14)10-5-11-27-18(24)15-6-3-2-4-7-15/h2-4,6-9,12,22-23H,5,10-11,13,21H2,1H3/t20-/m0/s1 |
| InChIKey | FUSXAVZXUDRESV-FQEVSTJZSA-N |
| XLogP | 2.15 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|