C20H24ClNO7 — CID 67214106
(2S)-3-(3,4-dihydroxyphenyl)-2-[3-(4-methoxybenzoyl)oxypropylamino]propanoic acid;hydrochloride (PubChem CID 67214106) has the molecular formula C20H24ClNO7 and a molecular weight of 425.87 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-[3-(4-methoxybenzoyl)oxypropylamino]propanoic acid;hydrochloride.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[3-(4-methoxybenzoyl)oxypropylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67214106 |
| Molecular Formula | C20H24ClNO7 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[3-(4-methoxybenzoyl)oxypropylamino]propanoic acid;hydrochloride |
| SMILES | COc1ccc(C(=O)OCCCN[C@@H](Cc2ccc(O)c(O)c2)C(=O)O)cc1.Cl |
| InChI | InChI=1S/C20H23NO7.ClH/c1-27-15-6-4-14(5-7-15)20(26)28-10-2-9-21-16(19(24)25)11-13-3-8-17(22)18(23)12-13;/h3-8,12,16,21-23H,2,9-11H2,1H3,(H,24,25);1H/t16-;/m0./s1 |
| InChIKey | KMTUJZCKBQXELG-NTISSMGPSA-N |
| XLogP | 2.36 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|