C19H20FNO6 — CID 67213740
2-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]ethyl 4-fluorobenzoate (PubChem CID 67213740) has the molecular formula C19H20FNO6 and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]ethyl 4-fluorobenzoate.
| Compound Name | 2-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]ethyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 67213740 |
| Molecular Formula | C19H20FNO6 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]ethyl 4-fluorobenzoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NCCOC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO6/c1-26-19(25)15(10-12-2-7-16(22)17(23)11-12)21-8-9-27-18(24)13-3-5-14(20)6-4-13/h2-7,11,15,21-23H,8-10H2,1H3/t15-/m0/s1 |
| InChIKey | ZCHJROLJBQIPGT-HNNXBMFYSA-N |
| XLogP | 1.77 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|