C18H18FNO6 — CID 67213671
(2S)-3-(3,4-dihydroxyphenyl)-2-[2-(4-fluorobenzoyl)oxyethylamino]propanoic acid (PubChem CID 67213671) has the molecular formula C18H18FNO6 and a molecular weight of 363.34 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-[2-(4-fluorobenzoyl)oxyethylamino]propanoic acid.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[2-(4-fluorobenzoyl)oxyethylamino]propanoic acid |
|---|---|
| PubChem CID | 67213671 |
| Molecular Formula | C18H18FNO6 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[2-(4-fluorobenzoyl)oxyethylamino]propanoic acid |
| SMILES | O=C(OCCN[C@@H](Cc1ccc(O)c(O)c1)C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FNO6/c19-13-4-2-12(3-5-13)18(25)26-8-7-20-14(17(23)24)9-11-1-6-15(21)16(22)10-11/h1-6,10,14,20-22H,7-9H2,(H,23,24)/t14-/m0/s1 |
| InChIKey | QBPFWYHCHHTIMJ-AWEZNQCLSA-N |
| XLogP | 1.68 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|