C12H16N2O5 — CID 174874928
4-amino-2-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoic acid (PubChem CID 174874928) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 4-amino-2-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174874928 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-amino-2-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NCCc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C12H16N2O5/c13-11(17)6-8(12(18)19)14-4-3-7-1-2-9(15)10(16)5-7/h1-2,5,8,14-16H,3-4,6H2,(H2,13,17)(H,18,19) |
| InChIKey | ZTUXIWMFHKLXDX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|