C24H23NO5 — CID 121288716
benzyl (2S)-3-(3,4-dihydroxyphenyl)-2-(phenacylamino)propanoate (PubChem CID 121288716) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is benzyl (2S)-3-(3,4-dihydroxyphenyl)-2-(phenacylamino)propanoate.
| Compound Name | benzyl (2S)-3-(3,4-dihydroxyphenyl)-2-(phenacylamino)propanoate |
|---|---|
| PubChem CID | 121288716 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | benzyl (2S)-3-(3,4-dihydroxyphenyl)-2-(phenacylamino)propanoate |
| SMILES | O=C(CN[C@@H](Cc1ccc(O)c(O)c1)C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO5/c26-21-12-11-18(14-22(21)27)13-20(24(29)30-16-17-7-3-1-4-8-17)25-15-23(28)19-9-5-2-6-10-19/h1-12,14,20,25-27H,13,15-16H2/t20-/m0/s1 |
| InChIKey | LBKZIAKPDQOJDG-FQEVSTJZSA-N |
| XLogP | 3.22 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|