C36H38N2O4 — CID 101163774
benzyl (2S)-2-[[(Z)-4-[[(2S)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]amino]but-2-enyl]amino]-3-phenylpropanoate (PubChem CID 101163774) has the molecular formula C36H38N2O4 and a molecular weight of 562.71 g/mol. Its IUPAC name is benzyl (2S)-2-[[(Z)-4-[[(2S)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]amino]but-2-enyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[(Z)-4-[[(2S)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]amino]but-2-enyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 101163774 |
| Molecular Formula | C36H38N2O4 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | benzyl (2S)-2-[[(Z)-4-[[(2S)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]amino]but-2-enyl]amino]-3-phenylpropanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](Cc1ccccc1)NC/C=C\CN[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H38N2O4/c39-35(41-27-31-19-9-3-10-20-31)33(25-29-15-5-1-6-16-29)37-23-13-14-24-38-34(26-30-17-7-2-8-18-30)36(40)42-28-32-21-11-4-12-22-32/h1-22,33-34,37-38H,23-28H2/b14-13-/t33-,34-/m0/s1 |
| InChIKey | LUFDFVUBTSVIOF-XLEBCTGCSA-N |
| XLogP | 5.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|