C25H25NO3 — CID 90959902
(2S)-2-[3-[4-(phenoxymethyl)phenyl]prop-2-enylamino]-3-phenylpropanoic acid (PubChem CID 90959902) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is (2S)-2-[3-[4-(phenoxymethyl)phenyl]prop-2-enylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[3-[4-(phenoxymethyl)phenyl]prop-2-enylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90959902 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (2S)-2-[3-[4-(phenoxymethyl)phenyl]prop-2-enylamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NCC=Cc1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO3/c27-25(28)24(18-21-8-3-1-4-9-21)26-17-7-10-20-13-15-22(16-14-20)19-29-23-11-5-2-6-12-23/h1-16,24,26H,17-19H2,(H,27,28)/t24-/m0/s1 |
| InChIKey | ZRPDSZITXFAJLY-DEOSSOPVSA-N |
| XLogP | 4.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |