C24H25NO5 — CID 130267090
(2S)-2-[[hydroxy-[[4-(phenoxymethyl)phenyl]methoxy]methyl]amino]-3-phenylpropanoic acid (PubChem CID 130267090) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is (2S)-2-[[hydroxy-[[4-(phenoxymethyl)phenyl]methoxy]methyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[hydroxy-[[4-(phenoxymethyl)phenyl]methoxy]methyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 130267090 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (2S)-2-[[hydroxy-[[4-(phenoxymethyl)phenyl]methoxy]methyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NC(O)OCc1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO5/c26-23(27)22(15-18-7-3-1-4-8-18)25-24(28)30-17-20-13-11-19(12-14-20)16-29-21-9-5-2-6-10-21/h1-14,22,24-25,28H,15-17H2,(H,26,27)/t22-,24?/m0/s1 |
| InChIKey | AONAJAVGAXTEGZ-OWJIYDKWSA-N |
| XLogP | 3.34 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|