C17H18O5 — CID 123215162
3,3-dihydroxy-2-[[4-(phenoxymethyl)phenyl]methyl]propanoic acid (PubChem CID 123215162) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3,3-dihydroxy-2-[[4-(phenoxymethyl)phenyl]methyl]propanoic acid.
| Compound Name | 3,3-dihydroxy-2-[[4-(phenoxymethyl)phenyl]methyl]propanoic acid |
|---|---|
| PubChem CID | 123215162 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3,3-dihydroxy-2-[[4-(phenoxymethyl)phenyl]methyl]propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(COc2ccccc2)cc1)C(O)O |
| InChI | InChI=1S/C17H18O5/c18-16(19)15(17(20)21)10-12-6-8-13(9-7-12)11-22-14-4-2-1-3-5-14/h1-9,15-16,18-19H,10-11H2,(H,20,21) |
| InChIKey | XZKFDPZTLJPLSR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|