C26H29N3O5 — CID 163553730
(2S)-N-[4-(2-amino-2-oxoethoxy)phenyl]-2-[[hydroxy(phenylmethoxy)methyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 163553730) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is (2S)-N-[4-(2-amino-2-oxoethoxy)phenyl]-2-[[hydroxy(phenylmethoxy)methyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | (2S)-N-[4-(2-amino-2-oxoethoxy)phenyl]-2-[[hydroxy(phenylmethoxy)methyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 163553730 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (2S)-N-[4-(2-amino-2-oxoethoxy)phenyl]-2-[[hydroxy(phenylmethoxy)methyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CN(C(=O)[C@H](Cc1ccccc1)NC(O)OCc1ccccc1)c1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C26H29N3O5/c1-29(21-12-14-22(15-13-21)33-18-24(27)30)25(31)23(16-19-8-4-2-5-9-19)28-26(32)34-17-20-10-6-3-7-11-20/h2-15,23,26,28,32H,16-18H2,1H3,(H2,27,30)/t23-,26?/m0/s1 |
| InChIKey | FLGNOKDMJQEUHS-ZZHFZYNASA-N |
| XLogP | 2.21 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|