C15H22ClN3O7 — CID 70587977
(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate;hydrate;hydrochloride (PubChem CID 70587977) has the molecular formula C15H22ClN3O7 and a molecular weight of 391.81 g/mol. Its IUPAC name is (3-methyl-2,5-dioxoimidazolidin-1-yl)methyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate;hydrate;hydrochloride.
| Compound Name | (3-methyl-2,5-dioxoimidazolidin-1-yl)methyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate;hydrate;hydrochloride |
|---|---|
| PubChem CID | 70587977 |
| Molecular Formula | C15H22ClN3O7 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (3-methyl-2,5-dioxoimidazolidin-1-yl)methyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate;hydrate;hydrochloride |
| SMILES | CN1CC(=O)N(COC(=O)[C@@](C)(N)Cc2ccc(O)c(O)c2)C1=O.Cl.O |
| InChI | InChI=1S/C15H19N3O6.ClH.H2O/c1-15(16,6-9-3-4-10(19)11(20)5-9)13(22)24-8-18-12(21)7-17(2)14(18)23;;/h3-5,19-20H,6-8,16H2,1-2H3;1H;1H2/t15-;;/m0../s1 |
| InChIKey | YVKWAOVCANRJHA-CKUXDGONSA-N |
| XLogP | -0.65 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|