C17H24N2O9 — CID 70587791
2-[4-[(2S)-3-(3-acetamidopropoxy)-2-amino-2-methyl-3-oxopropyl]-2-hydroxyphenoxy]-2-oxoacetic acid;hydrate (PubChem CID 70587791) has the molecular formula C17H24N2O9 and a molecular weight of 400.38 g/mol. Its IUPAC name is 2-[4-[(2S)-3-(3-acetamidopropoxy)-2-amino-2-methyl-3-oxopropyl]-2-hydroxyphenoxy]-2-oxoacetic acid;hydrate.
| Compound Name | 2-[4-[(2S)-3-(3-acetamidopropoxy)-2-amino-2-methyl-3-oxopropyl]-2-hydroxyphenoxy]-2-oxoacetic acid;hydrate |
|---|---|
| PubChem CID | 70587791 |
| Molecular Formula | C17H24N2O9 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-[4-[(2S)-3-(3-acetamidopropoxy)-2-amino-2-methyl-3-oxopropyl]-2-hydroxyphenoxy]-2-oxoacetic acid;hydrate |
| SMILES | CC(=O)NCCCOC(=O)[C@@](C)(N)Cc1ccc(OC(=O)C(=O)O)c(O)c1.O |
| InChI | InChI=1S/C17H22N2O8.H2O/c1-10(20)19-6-3-7-26-16(25)17(2,18)9-11-4-5-13(12(21)8-11)27-15(24)14(22)23;/h4-5,8,21H,3,6-7,9,18H2,1-2H3,(H,19,20)(H,22,23);1H2/t17-;/m0./s1 |
| InChIKey | LLAFKRUFKOUMKN-LMOVPXPDSA-N |
| XLogP | -1.11 |
| TPSA | 196.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|