C13H17NO4 — CID 67635917
prop-2-enyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate (PubChem CID 67635917) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is prop-2-enyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate.
| Compound Name | prop-2-enyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 67635917 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | prop-2-enyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate |
| SMILES | C=CCOC(=O)C(C)(N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H17NO4/c1-3-6-18-12(17)13(2,14)8-9-4-5-10(15)11(16)7-9/h3-5,7,15-16H,1,6,8,14H2,2H3 |
| InChIKey | WIKHHIZHEZWGCI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|