C15H23NO3 — CID 167241012
tert-butyl (2S)-2-amino-3-(3-hydroxy-4-methylphenyl)-2-methylpropanoate (PubChem CID 167241012) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-3-(3-hydroxy-4-methylphenyl)-2-methylpropanoate.
| Compound Name | tert-butyl (2S)-2-amino-3-(3-hydroxy-4-methylphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 167241012 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | tert-butyl (2S)-2-amino-3-(3-hydroxy-4-methylphenyl)-2-methylpropanoate |
| SMILES | Cc1ccc(C[C@](C)(N)C(=O)OC(C)(C)C)cc1O |
| InChI | InChI=1S/C15H23NO3/c1-10-6-7-11(8-12(10)17)9-15(5,16)13(18)19-14(2,3)4/h6-8,17H,9,16H2,1-5H3/t15-/m0/s1 |
| InChIKey | IFJUCPMPHWMMPL-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |