C15H22O4 — CID 22895335
3-(3,4-dihydroxyphenyl)propyl 2,2-dimethylbutanoate (PubChem CID 22895335) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)propyl 2,2-dimethylbutanoate.
| Compound Name | 3-(3,4-dihydroxyphenyl)propyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 22895335 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)propyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H22O4/c1-4-15(2,3)14(18)19-9-5-6-11-7-8-12(16)13(17)10-11/h7-8,10,16-17H,4-6,9H2,1-3H3 |
| InChIKey | YZGHFZAHAOVXSH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|